C18H16N3OS+ — CID 10947204
N,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazol-4-ium-7-carboxamide (PubChem CID 10947204) has the molecular formula C18H16N3OS+ and a molecular weight of 322.41 g/mol. Its IUPAC name is N,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazol-4-ium-7-carboxamide.
| Compound Name | N,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazol-4-ium-7-carboxamide |
|---|---|
| PubChem CID | 10947204 |
| Molecular Formula | C18H16N3OS+ |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazol-4-ium-7-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1CC[n+]2c(-c3ccccc3)csc21 |
| InChI | InChI=1S/C18H15N3OS/c22-17(19-15-9-5-2-6-10-15)21-12-11-20-16(13-23-18(20)21)14-7-3-1-4-8-14/h1-10,13H,11-12H2/p+1 |
| InChIKey | OZXIXVZRHAXBOI-UHFFFAOYSA-O |
| XLogP | 3.75 |
| TPSA | 36.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|