C20H25F3N4O2 — CID 109472219
2-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109472219) has the molecular formula C20H25F3N4O2 and a molecular weight of 410.44 g/mol. Its IUPAC name is 2-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109472219 |
| Molecular Formula | C20H25F3N4O2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 2-[[6-(2-ethoxyphenoxy)-3-pyridinyl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Oc2ccccc2OCC)nc1)NCCC(F)(F)F |
| InChI | InChI=1S/C20H25F3N4O2/c1-3-24-19(25-12-11-20(21,22)23)27-14-15-9-10-18(26-13-15)29-17-8-6-5-7-16(17)28-4-2/h5-10,13H,3-4,11-12,14H2,1-2H3,(H2,24,25,27) |
| InChIKey | OVVZKDXVOQMDGK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|