C16H30F3IN4 — CID 109472370
1-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109472370) has the molecular formula C16H30F3IN4 and a molecular weight of 462.34 g/mol. Its IUPAC name is 1-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109472370 |
| Molecular Formula | C16H30F3IN4 |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 1-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C=CCN(CC=C)C(CN/C(=N/C)NCCC(F)(F)F)C(C)C.I |
| InChI | InChI=1S/C16H29F3N4.HI/c1-6-10-23(11-7-2)14(13(3)4)12-22-15(20-5)21-9-8-16(17,18)19;/h6-7,13-14H,1-2,8-12H2,3-5H3,(H2,20,21,22);1H |
| InChIKey | CUXPSVDQKBLYCY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|