About methyl 3-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate
methyl 3-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate (PubChem CID 109472383) has the molecular formula C10H18F3N3O2
and a molecular weight of 269.27 g/mol. Its IUPAC name is methyl 3-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate.
Molecular Properties
| Compound Name | methyl 3-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate |
| PubChem CID | 109472383 |
| Molecular Formula | C10H18F3N3O2 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | methyl 3-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate |
| SMILES | CCN/C(=N\CCC(F)(F)F)NCCC(=O)OC |
| InChI | InChI=1S/C10H18F3N3O2/c1-3-14-9(15-6-4-8(17)18-2)16-7-5-10(11,12)13/h3-7H2,1-2H3,(H2,14,15,16) |
| InChIKey | FHQQOQVPEUXXSR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate?
The IUPAC name of methyl 3-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate (CID 109472383) is methyl 3-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate.
What is the SMILES notation for methyl 3-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate?
The canonical SMILES for methyl 3-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate is CCN/C(=N\CCC(F)(F)F)NCCC(=O)OC.
What is the InChIKey of methyl 3-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate?
The InChIKey is FHQQOQVPEUXXSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3N3O2/c1-3-14-9(15-6-4-8(17)18-2)16-7-5-10(11,12)13/h3-7H2,1-2H3,(H2,14,15,16).
What are the key properties of methyl 3-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate?
methyl 3-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate has a molecular weight of 269.27 g/mol, XLogP of 1.06, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanoate is sourced from PubChem (CID 109472383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).