C11H21F3N4O2 — CID 109472523
2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide (PubChem CID 109472523) has the molecular formula C11H21F3N4O2 and a molecular weight of 298.31 g/mol. Its IUPAC name is 2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 109472523 |
| Molecular Formula | C11H21F3N4O2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)NCCOC)NCCC(F)(F)F |
| InChI | InChI=1S/C11H21F3N4O2/c1-3-15-10(17-5-4-11(12,13)14)18-8-9(19)16-6-7-20-2/h3-8H2,1-2H3,(H,16,19)(H2,15,17,18) |
| InChIKey | BIHKWVVJAGKQOH-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|