C15H29F3N4 — CID 109472867
1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109472867) has the molecular formula C15H29F3N4 and a molecular weight of 322.42 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109472867 |
| Molecular Formula | C15H29F3N4 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CCC(F)(F)F)NCCN1CC(C)CC(C)C1 |
| InChI | InChI=1S/C15H29F3N4/c1-4-19-14(20-6-5-15(16,17)18)21-7-8-22-10-12(2)9-13(3)11-22/h12-13H,4-11H2,1-3H3,(H2,19,20,21) |
| InChIKey | JIXMUSLXJSHJRQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|