C17H27F3IN3O — CID 109473118
1-ethyl-2-[[2-(propoxymethyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109473118) has the molecular formula C17H27F3IN3O and a molecular weight of 473.32 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(propoxymethyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[2-(propoxymethyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109473118 |
| Molecular Formula | C17H27F3IN3O |
| Molecular Weight | 473.32 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 1-ethyl-2-[[2-(propoxymethyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCCOCc1ccccc1C/N=C(\NCC)NCCC(F)(F)F.I |
| InChI | InChI=1S/C17H26F3N3O.HI/c1-3-11-24-13-15-8-6-5-7-14(15)12-23-16(21-4-2)22-10-9-17(18,19)20;/h5-8H,3-4,9-13H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | JBHHZULMJBURAQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.32 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|