C14H25F3IN3O2 — CID 109473214
cyclopentyl 4-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]butanoate;hydroiodide (PubChem CID 109473214) has the molecular formula C14H25F3IN3O2 and a molecular weight of 451.27 g/mol. Its IUPAC name is cyclopentyl 4-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]butanoate;hydroiodide.
| Compound Name | cyclopentyl 4-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]butanoate;hydroiodide |
|---|---|
| PubChem CID | 109473214 |
| Molecular Formula | C14H25F3IN3O2 |
| Molecular Weight | 451.27 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | cyclopentyl 4-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]butanoate;hydroiodide |
| SMILES | C/N=C(/NCCCC(=O)OC1CCCC1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C14H24F3N3O2.HI/c1-18-13(20-10-8-14(15,16)17)19-9-4-7-12(21)22-11-5-2-3-6-11;/h11H,2-10H2,1H3,(H2,18,19,20);1H |
| InChIKey | CKANXDPEGKCQMR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|