C17H25BrF3IN4 — CID 109473400
2-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109473400) has the molecular formula C17H25BrF3IN4 and a molecular weight of 549.22 g/mol. Its IUPAC name is 2-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109473400 |
| Molecular Formula | C17H25BrF3IN4 |
| Molecular Weight | 549.22 g/mol |
| Exact Mass | 548.03 |
| IUPAC Name | 2-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(c2cccc(Br)c2)C1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C17H24BrF3N4.HI/c1-2-22-16(23-8-7-17(19,20)21)24-11-13-6-9-25(12-13)15-5-3-4-14(18)10-15;/h3-5,10,13H,2,6-9,11-12H2,1H3,(H2,22,23,24);1H |
| InChIKey | CYEHYJXNZFVSDD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.22 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|