C16H31F3N4O — CID 109473607
2-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109473607) has the molecular formula C16H31F3N4O and a molecular weight of 352.45 g/mol. Its IUPAC name is 2-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109473607 |
| Molecular Formula | C16H31F3N4O |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 2-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(C)N1CC(C)OC(C)C1)NCCC(F)(F)F |
| InChI | InChI=1S/C16H31F3N4O/c1-6-20-14(21-8-7-16(17,18)19)22-11-15(4,5)23-9-12(2)24-13(3)10-23/h12-13H,6-11H2,1-5H3,(H2,20,21,22) |
| InChIKey | CKYVYQRAGFSPRK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|