C16H30F3N5O2 — CID 109474543
tert-butyl 4-[2-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]ethyl]piperazine-1-carboxylate (PubChem CID 109474543) has the molecular formula C16H30F3N5O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is tert-butyl 4-[2-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 109474543 |
| Molecular Formula | C16H30F3N5O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | tert-butyl 4-[2-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]ethyl]piperazine-1-carboxylate |
| SMILES | C/N=C(/NCCN1CCN(C(=O)OC(C)(C)C)CC1)NCCC(F)(F)F |
| InChI | InChI=1S/C16H30F3N5O2/c1-15(2,3)26-14(25)24-11-9-23(10-12-24)8-7-22-13(20-4)21-6-5-16(17,18)19/h5-12H2,1-4H3,(H2,20,21,22) |
| InChIKey | FUZBQVDGLSDWJH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|