C18H33F3N4O2 — CID 109474673
tert-butyl 3-[2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]ethyl]piperidine-1-carboxylate (PubChem CID 109474673) has the molecular formula C18H33F3N4O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is tert-butyl 3-[2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109474673 |
| Molecular Formula | C18H33F3N4O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | tert-butyl 3-[2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]ethyl]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\CCC1CCCN(C(=O)OC(C)(C)C)C1)NCCC(F)(F)F |
| InChI | InChI=1S/C18H33F3N4O2/c1-5-22-15(24-11-9-18(19,20)21)23-10-8-14-7-6-12-25(13-14)16(26)27-17(2,3)4/h14H,5-13H2,1-4H3,(H2,22,23,24) |
| InChIKey | QXNJBURFOLFVCL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|