C16H23BrF3IN4 — CID 109474788
1-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109474788) has the molecular formula C16H23BrF3IN4 and a molecular weight of 535.19 g/mol. Its IUPAC name is 1-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109474788 |
| Molecular Formula | C16H23BrF3IN4 |
| Molecular Weight | 535.19 g/mol |
| Exact Mass | 534.01 |
| IUPAC Name | 1-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(F)(F)F)NCC1CCN(c2cccc(Br)c2)C1.I |
| InChI | InChI=1S/C16H22BrF3N4.HI/c1-21-15(22-7-6-16(18,19)20)23-10-12-5-8-24(11-12)14-4-2-3-13(17)9-14;/h2-4,9,12H,5-8,10-11H2,1H3,(H2,21,22,23);1H |
| InChIKey | TWLPTAFPOSJALM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.19 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|