C13H25F3IN3O3S — CID 109475060
1-ethyl-2-[(4-methylsulfonyloxan-4-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109475060) has the molecular formula C13H25F3IN3O3S and a molecular weight of 487.33 g/mol. Its IUPAC name is 1-ethyl-2-[(4-methylsulfonyloxan-4-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(4-methylsulfonyloxan-4-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109475060 |
| Molecular Formula | C13H25F3IN3O3S |
| Molecular Weight | 487.33 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | 1-ethyl-2-[(4-methylsulfonyloxan-4-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(S(C)(=O)=O)CCOCC1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C13H24F3N3O3S.HI/c1-3-17-11(18-7-4-13(14,15)16)19-10-12(23(2,20)21)5-8-22-9-6-12;/h3-10H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | RGNPTQUTXDAPJA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|