C15H33NO3Si2 — CID 10947531
tert-butyl (3R)-2-trimethylsilyl-3-trimethylsilyloxypyrrolidine-1-carboxylate (PubChem CID 10947531) has the molecular formula C15H33NO3Si2 and a molecular weight of 331.61 g/mol. Its IUPAC name is tert-butyl (3R)-2-trimethylsilyl-3-trimethylsilyloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-2-trimethylsilyl-3-trimethylsilyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10947531 |
| Molecular Formula | C15H33NO3Si2 |
| Molecular Weight | 331.61 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | tert-butyl (3R)-2-trimethylsilyl-3-trimethylsilyloxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](O[Si](C)(C)C)C1[Si](C)(C)C |
| InChI | InChI=1S/C15H33NO3Si2/c1-15(2,3)18-14(17)16-11-10-12(19-21(7,8)9)13(16)20(4,5)6/h12-13H,10-11H2,1-9H3/t12-,13?/m1/s1 |
| InChIKey | FDDJLNUISUTVPX-PZORYLMUSA-N |
| XLogP | 4.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.61 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|