C15H28O6Si — CID 10947566
(2S,3S)-2-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-3-(methoxymethoxy)-2,3-dihydropyran-6-one (PubChem CID 10947566) has the molecular formula C15H28O6Si and a molecular weight of 332.47 g/mol. Its IUPAC name is (2S,3S)-2-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-3-(methoxymethoxy)-2,3-dihydropyran-6-one.
| Compound Name | (2S,3S)-2-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-3-(methoxymethoxy)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 10947566 |
| Molecular Formula | C15H28O6Si |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (2S,3S)-2-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-3-(methoxymethoxy)-2,3-dihydropyran-6-one |
| SMILES | COCO[C@H]1C=CC(=O)O[C@H]1[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H28O6Si/c1-15(2,3)22(5,6)20-9-11(16)14-12(19-10-18-4)7-8-13(17)21-14/h7-8,11-12,14,16H,9-10H2,1-6H3/t11-,12+,14+/m1/s1 |
| InChIKey | GFUWVXQWYSMPME-DYEKYZERSA-N |
| XLogP | 1.84 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|