C25H35FIN3O3 — CID 109476102
1-[2-(3-fluorophenoxy)butyl]-2-methyl-3-[[4-(oxan-4-yloxymethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 109476102) has the molecular formula C25H35FIN3O3 and a molecular weight of 571.48 g/mol. Its IUPAC name is 1-[2-(3-fluorophenoxy)butyl]-2-methyl-3-[[4-(oxan-4-yloxymethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-fluorophenoxy)butyl]-2-methyl-3-[[4-(oxan-4-yloxymethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109476102 |
| Molecular Formula | C25H35FIN3O3 |
| Molecular Weight | 571.48 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | 1-[2-(3-fluorophenoxy)butyl]-2-methyl-3-[[4-(oxan-4-yloxymethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCC(CN/C(=N\C)NCc1ccc(COC2CCOCC2)cc1)Oc1cccc(F)c1.I |
| InChI | InChI=1S/C25H34FN3O3.HI/c1-3-22(32-24-6-4-5-21(26)15-24)17-29-25(27-2)28-16-19-7-9-20(10-8-19)18-31-23-11-13-30-14-12-23;/h4-10,15,22-23H,3,11-14,16-18H2,1-2H3,(H2,27,28,29);1H |
| InChIKey | PELGUHWPCOKTHW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|