C15H11ClF5N — CID 10947665
N-benzyl-4-chloro-N-(1,1,2,2,2-pentafluoroethyl)aniline (PubChem CID 10947665) has the molecular formula C15H11ClF5N and a molecular weight of 335.70 g/mol. Its IUPAC name is N-benzyl-4-chloro-N-(1,1,2,2,2-pentafluoroethyl)aniline.
| Compound Name | N-benzyl-4-chloro-N-(1,1,2,2,2-pentafluoroethyl)aniline |
|---|---|
| PubChem CID | 10947665 |
| Molecular Formula | C15H11ClF5N |
| Molecular Weight | 335.70 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | N-benzyl-4-chloro-N-(1,1,2,2,2-pentafluoroethyl)aniline |
| SMILES | FC(F)(F)C(F)(F)N(Cc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H11ClF5N/c16-12-6-8-13(9-7-12)22(15(20,21)14(17,18)19)10-11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | RZOLYAJDNWRTON-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.70 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|