C19H31FIN3O2 — CID 109477657
1-ethyl-2-[(3-fluoro-4-hydroxyphenyl)methyl]-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine;hydroiodide (PubChem CID 109477657) has the molecular formula C19H31FIN3O2 and a molecular weight of 479.38 g/mol. Its IUPAC name is 1-ethyl-2-[(3-fluoro-4-hydroxyphenyl)methyl]-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(3-fluoro-4-hydroxyphenyl)methyl]-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109477657 |
| Molecular Formula | C19H31FIN3O2 |
| Molecular Weight | 479.38 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 1-ethyl-2-[(3-fluoro-4-hydroxyphenyl)methyl]-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(O)c(F)c1)NCC1(CCO)CCCCC1.I |
| InChI | InChI=1S/C19H30FN3O2.HI/c1-2-21-18(22-13-15-6-7-17(25)16(20)12-15)23-14-19(10-11-24)8-4-3-5-9-19;/h6-7,12,24-25H,2-5,8-11,13-14H2,1H3,(H2,21,22,23);1H |
| InChIKey | CZILZSBUBHEJPN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|