C18H31N3O2 — CID 109478202
5-ethyl-N-[(2-hydroxy-1-methylcyclohexyl)methyl]-1-(2-methylpropyl)pyrazole-4-carboxamide (PubChem CID 109478202) has the molecular formula C18H31N3O2 and a molecular weight of 321.47 g/mol. Its IUPAC name is 5-ethyl-N-[(2-hydroxy-1-methylcyclohexyl)methyl]-1-(2-methylpropyl)pyrazole-4-carboxamide.
| Compound Name | 5-ethyl-N-[(2-hydroxy-1-methylcyclohexyl)methyl]-1-(2-methylpropyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 109478202 |
| Molecular Formula | C18H31N3O2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | 5-ethyl-N-[(2-hydroxy-1-methylcyclohexyl)methyl]-1-(2-methylpropyl)pyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)NCC2(C)CCCCC2O)cnn1CC(C)C |
| InChI | InChI=1S/C18H31N3O2/c1-5-15-14(10-20-21(15)11-13(2)3)17(23)19-12-18(4)9-7-6-8-16(18)22/h10,13,16,22H,5-9,11-12H2,1-4H3,(H,19,23) |
| InChIKey | AGSFTBRPMWKDMW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |