C16H19F2N3O3 — CID 109479137
5-[3-(difluoromethoxy)phenyl]-N-(1-hydroxypentan-3-yl)-1H-pyrazole-4-carboxamide (PubChem CID 109479137) has the molecular formula C16H19F2N3O3 and a molecular weight of 339.34 g/mol. Its IUPAC name is 5-[3-(difluoromethoxy)phenyl]-N-(1-hydroxypentan-3-yl)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[3-(difluoromethoxy)phenyl]-N-(1-hydroxypentan-3-yl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 109479137 |
| Molecular Formula | C16H19F2N3O3 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 5-[3-(difluoromethoxy)phenyl]-N-(1-hydroxypentan-3-yl)-1H-pyrazole-4-carboxamide |
| SMILES | CCC(CCO)NC(=O)c1cn[nH]c1-c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C16H19F2N3O3/c1-2-11(6-7-22)20-15(23)13-9-19-21-14(13)10-4-3-5-12(8-10)24-16(17)18/h3-5,8-9,11,16,22H,2,6-7H2,1H3,(H,19,21)(H,20,23) |
| InChIKey | KGSRHTJVPFBNNT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |