C22H30IN3O2 — CID 109479510
N-ethyl-N'-[2-(3-hydroxyphenyl)ethyl]-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide (PubChem CID 109479510) has the molecular formula C22H30IN3O2 and a molecular weight of 495.41 g/mol. Its IUPAC name is N-ethyl-N'-[2-(3-hydroxyphenyl)ethyl]-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-(3-hydroxyphenyl)ethyl]-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109479510 |
| Molecular Formula | C22H30IN3O2 |
| Molecular Weight | 495.41 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | N-ethyl-N'-[2-(3-hydroxyphenyl)ethyl]-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1cccc(O)c1)N1CCOC(c2ccccc2C)C1.I |
| InChI | InChI=1S/C22H29N3O2.HI/c1-3-23-22(24-12-11-18-8-6-9-19(26)15-18)25-13-14-27-21(16-25)20-10-5-4-7-17(20)2;/h4-10,15,21,26H,3,11-14,16H2,1-2H3,(H,23,24);1H |
| InChIKey | JPMHSRYSQGAJTF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|