About 2-ethyl-N,N-bis[(2E)-octa-2,7-dienyl]hexan-1-amine
2-ethyl-N,N-bis[(2E)-octa-2,7-dienyl]hexan-1-amine (PubChem CID 10947963) has the molecular formula C24H43N
and a molecular weight of 345.62 g/mol. Its IUPAC name is 2-ethyl-N,N-bis[(2E)-octa-2,7-dienyl]hexan-1-amine.
Molecular Properties
| Compound Name | 2-ethyl-N,N-bis[(2E)-octa-2,7-dienyl]hexan-1-amine |
| PubChem CID | 10947963 |
| Molecular Formula | C24H43N |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 345.34 |
| IUPAC Name | 2-ethyl-N,N-bis[(2E)-octa-2,7-dienyl]hexan-1-amine |
| SMILES | C=CCCC/C=C/CN(C/C=C/CCCC=C)CC(CC)CCCC |
| InChI | InChI=1S/C24H43N/c1-5-9-12-14-16-18-21-25(22-19-17-15-13-10-6-2)23-24(8-4)20-11-7-3/h5-6,16-19,24H,1-2,7-15,20-23H2,3-4H3/b18-16+,19-17+ |
| InChIKey | VYLNXASLJMSATD-YWNVXTCZSA-N |
| XLogP | 7.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-N,N-bis[(2E)-octa-2,7-dienyl]hexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N,N-bis[(2E)-octa-2,7-dienyl]hexan-1-amine?
The IUPAC name of 2-ethyl-N,N-bis[(2E)-octa-2,7-dienyl]hexan-1-amine (CID 10947963) is 2-ethyl-N,N-bis[(2E)-octa-2,7-dienyl]hexan-1-amine.
What is the SMILES notation for 2-ethyl-N,N-bis[(2E)-octa-2,7-dienyl]hexan-1-amine?
The canonical SMILES for 2-ethyl-N,N-bis[(2E)-octa-2,7-dienyl]hexan-1-amine is C=CCCC/C=C/CN(C/C=C/CCCC=C)CC(CC)CCCC.
What is the InChIKey of 2-ethyl-N,N-bis[(2E)-octa-2,7-dienyl]hexan-1-amine?
The InChIKey is VYLNXASLJMSATD-YWNVXTCZSA-N. The full InChI is InChI=1S/C24H43N/c1-5-9-12-14-16-18-21-25(22-19-17-15-13-10-6-2)23-24(8-4)20-11-7-3/h5-6,16-19,24H,1-2,7-15,20-23H2,3-4H3/b18-16+,19-17+.
What are the key properties of 2-ethyl-N,N-bis[(2E)-octa-2,7-dienyl]hexan-1-amine?
2-ethyl-N,N-bis[(2E)-octa-2,7-dienyl]hexan-1-amine has a molecular weight of 345.62 g/mol, XLogP of 7.33, 18 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N,N-bis[(2E)-octa-2,7-dienyl]hexan-1-amine is sourced from PubChem (CID 10947963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).