C22H30IN3O2S — CID 109479698
N'-[2-(benzenesulfinyl)ethyl]-N-ethyl-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide (PubChem CID 109479698) has the molecular formula C22H30IN3O2S and a molecular weight of 527.47 g/mol. Its IUPAC name is N'-[2-(benzenesulfinyl)ethyl]-N-ethyl-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(benzenesulfinyl)ethyl]-N-ethyl-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109479698 |
| Molecular Formula | C22H30IN3O2S |
| Molecular Weight | 527.47 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | N'-[2-(benzenesulfinyl)ethyl]-N-ethyl-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCS(=O)c1ccccc1)N1CCOC(c2ccccc2C)C1.I |
| InChI | InChI=1S/C22H29N3O2S.HI/c1-3-23-22(24-13-16-28(26)19-10-5-4-6-11-19)25-14-15-27-21(17-25)20-12-8-7-9-18(20)2;/h4-12,21H,3,13-17H2,1-2H3,(H,23,24);1H |
| InChIKey | HUNBMKJUXLKOCY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|