About pentan-2-yl carbamate
pentan-2-yl carbamate (PubChem CID 10948) has the molecular formula C6H13NO2
and a molecular weight of 131.17 g/mol. Its IUPAC name is pentan-2-yl carbamate.
Molecular Properties
| Compound Name | pentan-2-yl carbamate |
| PubChem CID | 10948 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | pentan-2-yl carbamate |
| SMILES | CCCC(C)OC(N)=O |
| InChI | InChI=1S/C6H13NO2/c1-3-4-5(2)9-6(7)8/h5H,3-4H2,1-2H3,(H2,7,8) |
| InChIKey | HZMVPSHLMIQQNX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pentan-2-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-yl carbamate?
The IUPAC name of pentan-2-yl carbamate (CID 10948) is pentan-2-yl carbamate.
What is the SMILES notation for pentan-2-yl carbamate?
The canonical SMILES for pentan-2-yl carbamate is CCCC(C)OC(N)=O.
What is the InChIKey of pentan-2-yl carbamate?
The InChIKey is HZMVPSHLMIQQNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2/c1-3-4-5(2)9-6(7)8/h5H,3-4H2,1-2H3,(H2,7,8).
What are the key properties of pentan-2-yl carbamate?
pentan-2-yl carbamate has a molecular weight of 131.17 g/mol, XLogP of 1.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-yl carbamate is sourced from PubChem (CID 10948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).