C21H21N3O2 — CID 10948013
(E)-N-hydroxy-3-[4-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)phenyl]prop-2-enamide (PubChem CID 10948013) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[4-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[4-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 10948013 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (E)-N-hydroxy-3-[4-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(CN2CCc3c([nH]c4ccccc34)C2)cc1)NO |
| InChI | InChI=1S/C21H21N3O2/c25-21(23-26)10-9-15-5-7-16(8-6-15)13-24-12-11-18-17-3-1-2-4-19(17)22-20(18)14-24/h1-10,22,26H,11-14H2,(H,23,25)/b10-9+ |
| InChIKey | UPLNFMGGXWLBTC-MDZDMXLPSA-N |
| XLogP | 3.24 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|