C17H33ClO3Si — CID 10948058
methyl (1R,2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2-chloropropan-2-yl)-2-methylcyclopentane-1-carboxylate (PubChem CID 10948058) has the molecular formula C17H33ClO3Si and a molecular weight of 348.99 g/mol. Its IUPAC name is methyl (1R,2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2-chloropropan-2-yl)-2-methylcyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2-chloropropan-2-yl)-2-methylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 10948058 |
| Molecular Formula | C17H33ClO3Si |
| Molecular Weight | 348.99 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | methyl (1R,2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2-chloropropan-2-yl)-2-methylcyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(C)(C)Cl |
| InChI | InChI=1S/C17H33ClO3Si/c1-11-13(21-22(8,9)16(2,3)4)10-12(17(5,6)18)14(11)15(19)20-7/h11-14H,10H2,1-9H3/t11-,12+,13+,14+/m0/s1 |
| InChIKey | OAKUIYVBAYFYNN-REWJHTLYSA-N |
| XLogP | 4.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.99 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|