About (9Z,12Z)-1-morpholin-4-yloctadeca-9,12-dien-1-one
(9Z,12Z)-1-morpholin-4-yloctadeca-9,12-dien-1-one (PubChem CID 10948080) has the molecular formula C22H39NO2
and a molecular weight of 349.56 g/mol. Its IUPAC name is (9Z,12Z)-1-morpholin-4-yloctadeca-9,12-dien-1-one.
Molecular Properties
| Compound Name | (9Z,12Z)-1-morpholin-4-yloctadeca-9,12-dien-1-one |
| PubChem CID | 10948080 |
| Molecular Formula | C22H39NO2 |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.30 |
| IUPAC Name | (9Z,12Z)-1-morpholin-4-yloctadeca-9,12-dien-1-one |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C22H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(24)23-18-20-25-21-19-23/h6-7,9-10H,2-5,8,11-21H2,1H3/b7-6-,10-9- |
| InChIKey | SAXWRYKJXPLEKS-HZJYTTRNSA-N |
| XLogP | 5.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (9Z,12Z)-1-morpholin-4-yloctadeca-9,12-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9Z,12Z)-1-morpholin-4-yloctadeca-9,12-dien-1-one?
The IUPAC name of (9Z,12Z)-1-morpholin-4-yloctadeca-9,12-dien-1-one (CID 10948080) is (9Z,12Z)-1-morpholin-4-yloctadeca-9,12-dien-1-one.
What is the SMILES notation for (9Z,12Z)-1-morpholin-4-yloctadeca-9,12-dien-1-one?
The canonical SMILES for (9Z,12Z)-1-morpholin-4-yloctadeca-9,12-dien-1-one is CCCCC/C=C\C/C=C\CCCCCCCC(=O)N1CCOCC1.
What is the InChIKey of (9Z,12Z)-1-morpholin-4-yloctadeca-9,12-dien-1-one?
The InChIKey is SAXWRYKJXPLEKS-HZJYTTRNSA-N. The full InChI is InChI=1S/C22H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(24)23-18-20-25-21-19-23/h6-7,9-10H,2-5,8,11-21H2,1H3/b7-6-,10-9-.
What are the key properties of (9Z,12Z)-1-morpholin-4-yloctadeca-9,12-dien-1-one?
(9Z,12Z)-1-morpholin-4-yloctadeca-9,12-dien-1-one has a molecular weight of 349.56 g/mol, XLogP of 5.66, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (9Z,12Z)-1-morpholin-4-yloctadeca-9,12-dien-1-one is sourced from PubChem (CID 10948080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).