C22H35N3O2 — CID 109481060
N-ethyl-N'-[[1-(2-methoxyethyl)cyclobutyl]methyl]-2-(2-methylphenyl)morpholine-4-carboximidamide (PubChem CID 109481060) has the molecular formula C22H35N3O2 and a molecular weight of 373.54 g/mol. Its IUPAC name is N-ethyl-N'-[[1-(2-methoxyethyl)cyclobutyl]methyl]-2-(2-methylphenyl)morpholine-4-carboximidamide.
| Compound Name | N-ethyl-N'-[[1-(2-methoxyethyl)cyclobutyl]methyl]-2-(2-methylphenyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109481060 |
| Molecular Formula | C22H35N3O2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | N-ethyl-N'-[[1-(2-methoxyethyl)cyclobutyl]methyl]-2-(2-methylphenyl)morpholine-4-carboximidamide |
| SMILES | CCN/C(=N\CC1(CCOC)CCC1)N1CCOC(c2ccccc2C)C1 |
| InChI | InChI=1S/C22H35N3O2/c1-4-23-21(24-17-22(10-7-11-22)12-14-26-3)25-13-15-27-20(16-25)19-9-6-5-8-18(19)2/h5-6,8-9,20H,4,7,10-17H2,1-3H3,(H,23,24) |
| InChIKey | YNNOLDKTGCPECN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|