C23H34N6O2 — CID 109481298
N-ethyl-2-(2-methylphenyl)-N'-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]morpholine-4-carboximidamide (PubChem CID 109481298) has the molecular formula C23H34N6O2 and a molecular weight of 426.57 g/mol. Its IUPAC name is N-ethyl-2-(2-methylphenyl)-N'-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]morpholine-4-carboximidamide.
| Compound Name | N-ethyl-2-(2-methylphenyl)-N'-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109481298 |
| Molecular Formula | C23H34N6O2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | N-ethyl-2-(2-methylphenyl)-N'-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]morpholine-4-carboximidamide |
| SMILES | CCN/C(=N\CCCn1nc2n(c1=O)CCCC2)N1CCOC(c2ccccc2C)C1 |
| InChI | InChI=1S/C23H34N6O2/c1-3-24-22(27-15-16-31-20(17-27)19-10-5-4-9-18(19)2)25-12-8-14-29-23(30)28-13-7-6-11-21(28)26-29/h4-5,9-10,20H,3,6-8,11-17H2,1-2H3,(H,24,25) |
| InChIKey | ZMSPQLKLEKPCLK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|