About 2-[5-[(3,5-difluorophenyl)methylamino]-3-thiophen-2-ylpyrazol-1-yl]ethanol
2-[5-[(3,5-difluorophenyl)methylamino]-3-thiophen-2-ylpyrazol-1-yl]ethanol (PubChem CID 109481725) has the molecular formula C16H15F2N3OS
and a molecular weight of 335.38 g/mol. Its IUPAC name is 2-[5-[(3,5-difluorophenyl)methylamino]-3-thiophen-2-ylpyrazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[5-[(3,5-difluorophenyl)methylamino]-3-thiophen-2-ylpyrazol-1-yl]ethanol |
| PubChem CID | 109481725 |
| Molecular Formula | C16H15F2N3OS |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-[5-[(3,5-difluorophenyl)methylamino]-3-thiophen-2-ylpyrazol-1-yl]ethanol |
| SMILES | OCCn1nc(-c2cccs2)cc1NCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H15F2N3OS/c17-12-6-11(7-13(18)8-12)10-19-16-9-14(15-2-1-5-23-15)20-21(16)3-4-22/h1-2,5-9,19,22H,3-4,10H2 |
| InChIKey | XINDZTJBMIMWHF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-[(3,5-difluorophenyl)methylamino]-3-thiophen-2-ylpyrazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[(3,5-difluorophenyl)methylamino]-3-thiophen-2-ylpyrazol-1-yl]ethanol?
The IUPAC name of 2-[5-[(3,5-difluorophenyl)methylamino]-3-thiophen-2-ylpyrazol-1-yl]ethanol (CID 109481725) is 2-[5-[(3,5-difluorophenyl)methylamino]-3-thiophen-2-ylpyrazol-1-yl]ethanol.
What is the SMILES notation for 2-[5-[(3,5-difluorophenyl)methylamino]-3-thiophen-2-ylpyrazol-1-yl]ethanol?
The canonical SMILES for 2-[5-[(3,5-difluorophenyl)methylamino]-3-thiophen-2-ylpyrazol-1-yl]ethanol is OCCn1nc(-c2cccs2)cc1NCc1cc(F)cc(F)c1.
What is the InChIKey of 2-[5-[(3,5-difluorophenyl)methylamino]-3-thiophen-2-ylpyrazol-1-yl]ethanol?
The InChIKey is XINDZTJBMIMWHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F2N3OS/c17-12-6-11(7-13(18)8-12)10-19-16-9-14(15-2-1-5-23-15)20-21(16)3-4-22/h1-2,5-9,19,22H,3-4,10H2.
What are the key properties of 2-[5-[(3,5-difluorophenyl)methylamino]-3-thiophen-2-ylpyrazol-1-yl]ethanol?
2-[5-[(3,5-difluorophenyl)methylamino]-3-thiophen-2-ylpyrazol-1-yl]ethanol has a molecular weight of 335.38 g/mol, XLogP of 3.49, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[(3,5-difluorophenyl)methylamino]-3-thiophen-2-ylpyrazol-1-yl]ethanol is sourced from PubChem (CID 109481725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).