About 4-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]pentan-1-ol
4-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]pentan-1-ol (PubChem CID 109482221) has the molecular formula C15H29N3O
and a molecular weight of 267.42 g/mol. Its IUPAC name is 4-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]pentan-1-ol.
Molecular Properties
| Compound Name | 4-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]pentan-1-ol |
| PubChem CID | 109482221 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | 4-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]pentan-1-ol |
| SMILES | Cc1nn(C(C)(C)C)c(C)c1CNC(C)CCCO |
| InChI | InChI=1S/C15H29N3O/c1-11(8-7-9-19)16-10-14-12(2)17-18(13(14)3)15(4,5)6/h11,16,19H,7-10H2,1-6H3 |
| InChIKey | JZOLTWHVSSUMAP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]pentan-1-ol?
The IUPAC name of 4-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]pentan-1-ol (CID 109482221) is 4-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]pentan-1-ol.
What is the SMILES notation for 4-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]pentan-1-ol?
The canonical SMILES for 4-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]pentan-1-ol is Cc1nn(C(C)(C)C)c(C)c1CNC(C)CCCO.
What is the InChIKey of 4-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]pentan-1-ol?
The InChIKey is JZOLTWHVSSUMAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N3O/c1-11(8-7-9-19)16-10-14-12(2)17-18(13(14)3)15(4,5)6/h11,16,19H,7-10H2,1-6H3.
What are the key properties of 4-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]pentan-1-ol?
4-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]pentan-1-ol has a molecular weight of 267.42 g/mol, XLogP of 2.51, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]pentan-1-ol is sourced from PubChem (CID 109482221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).