C4H3Br2Cl2F3O — CID 10948225
1,2-dibromo-1,2-dichloro-3,3,3-trifluoro-1-methoxypropane (PubChem CID 10948225) has the molecular formula C4H3Br2Cl2F3O and a molecular weight of 354.78 g/mol. Its IUPAC name is 1,2-dibromo-1,2-dichloro-3,3,3-trifluoro-1-methoxypropane.
| Compound Name | 1,2-dibromo-1,2-dichloro-3,3,3-trifluoro-1-methoxypropane |
|---|---|
| PubChem CID | 10948225 |
| Molecular Formula | C4H3Br2Cl2F3O |
| Molecular Weight | 354.78 g/mol |
| Exact Mass | 351.79 |
| IUPAC Name | 1,2-dibromo-1,2-dichloro-3,3,3-trifluoro-1-methoxypropane |
| SMILES | COC(Cl)(Br)C(Cl)(Br)C(F)(F)F |
| InChI | InChI=1S/C4H3Br2Cl2F3O/c1-12-3(6,8)2(5,7)4(9,10)11/h1H3 |
| InChIKey | CUBVSMNKYJPGEZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.78 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|