About 3-(cyclopropylmethyl)-1-hept-6-enyl-1,2-dimethylguanidine
3-(cyclopropylmethyl)-1-hept-6-enyl-1,2-dimethylguanidine (PubChem CID 109483025) has the molecular formula C14H27N3
and a molecular weight of 237.39 g/mol. Its IUPAC name is 3-(cyclopropylmethyl)-1-hept-6-enyl-1,2-dimethylguanidine.
Molecular Properties
| Compound Name | 3-(cyclopropylmethyl)-1-hept-6-enyl-1,2-dimethylguanidine |
| PubChem CID | 109483025 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | 3-(cyclopropylmethyl)-1-hept-6-enyl-1,2-dimethylguanidine |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCC1CC1 |
| InChI | InChI=1S/C14H27N3/c1-4-5-6-7-8-11-17(3)14(15-2)16-12-13-9-10-13/h4,13H,1,5-12H2,2-3H3,(H,15,16) |
| InChIKey | KLSKOKLONLSGDS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(cyclopropylmethyl)-1-hept-6-enyl-1,2-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclopropylmethyl)-1-hept-6-enyl-1,2-dimethylguanidine?
The IUPAC name of 3-(cyclopropylmethyl)-1-hept-6-enyl-1,2-dimethylguanidine (CID 109483025) is 3-(cyclopropylmethyl)-1-hept-6-enyl-1,2-dimethylguanidine.
What is the SMILES notation for 3-(cyclopropylmethyl)-1-hept-6-enyl-1,2-dimethylguanidine?
The canonical SMILES for 3-(cyclopropylmethyl)-1-hept-6-enyl-1,2-dimethylguanidine is C=CCCCCCN(C)/C(=N\C)NCC1CC1.
What is the InChIKey of 3-(cyclopropylmethyl)-1-hept-6-enyl-1,2-dimethylguanidine?
The InChIKey is KLSKOKLONLSGDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N3/c1-4-5-6-7-8-11-17(3)14(15-2)16-12-13-9-10-13/h4,13H,1,5-12H2,2-3H3,(H,15,16).
What are the key properties of 3-(cyclopropylmethyl)-1-hept-6-enyl-1,2-dimethylguanidine?
3-(cyclopropylmethyl)-1-hept-6-enyl-1,2-dimethylguanidine has a molecular weight of 237.39 g/mol, XLogP of 2.65, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclopropylmethyl)-1-hept-6-enyl-1,2-dimethylguanidine is sourced from PubChem (CID 109483025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).