About 3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N,N-dimethylpropanamide
3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N,N-dimethylpropanamide (PubChem CID 109483049) has the molecular formula C15H30N4O
and a molecular weight of 282.43 g/mol. Its IUPAC name is 3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N,N-dimethylpropanamide |
| PubChem CID | 109483049 |
| Molecular Formula | C15H30N4O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | 3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N,N-dimethylpropanamide |
| SMILES | C=CCCCCCN(C)/C(=N/C)NCCC(=O)N(C)C |
| InChI | InChI=1S/C15H30N4O/c1-6-7-8-9-10-13-19(5)15(16-2)17-12-11-14(20)18(3)4/h6H,1,7-13H2,2-5H3,(H,16,17) |
| InChIKey | XCQBQIWKOGQSCX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N,N-dimethylpropanamide?
The IUPAC name of 3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N,N-dimethylpropanamide (CID 109483049) is 3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N,N-dimethylpropanamide.
What is the SMILES notation for 3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N,N-dimethylpropanamide?
The canonical SMILES for 3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N,N-dimethylpropanamide is C=CCCCCCN(C)/C(=N/C)NCCC(=O)N(C)C.
What is the InChIKey of 3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N,N-dimethylpropanamide?
The InChIKey is XCQBQIWKOGQSCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N4O/c1-6-7-8-9-10-13-19(5)15(16-2)17-12-11-14(20)18(3)4/h6H,1,7-13H2,2-5H3,(H,16,17).
What are the key properties of 3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N,N-dimethylpropanamide?
3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N,N-dimethylpropanamide has a molecular weight of 282.43 g/mol, XLogP of 1.72, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N,N-dimethylpropanamide is sourced from PubChem (CID 109483049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).