C17H36N4 — CID 109483063
2-[2-(tert-butylamino)ethyl]-3-ethyl-1-hept-6-enyl-1-methylguanidine (PubChem CID 109483063) has the molecular formula C17H36N4 and a molecular weight of 296.50 g/mol. Its IUPAC name is 2-[2-(tert-butylamino)ethyl]-3-ethyl-1-hept-6-enyl-1-methylguanidine.
| Compound Name | 2-[2-(tert-butylamino)ethyl]-3-ethyl-1-hept-6-enyl-1-methylguanidine |
|---|---|
| PubChem CID | 109483063 |
| Molecular Formula | C17H36N4 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.29 |
| IUPAC Name | 2-[2-(tert-butylamino)ethyl]-3-ethyl-1-hept-6-enyl-1-methylguanidine |
| SMILES | C=CCCCCCN(C)/C(=N\CCNC(C)(C)C)NCC |
| InChI | InChI=1S/C17H36N4/c1-7-9-10-11-12-15-21(6)16(18-8-2)19-13-14-20-17(3,4)5/h7,20H,1,8-15H2,2-6H3,(H,18,19) |
| InChIKey | LMKVTGKQFRKLDA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|