C15H27N5O2 — CID 109483075
3-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine (PubChem CID 109483075) has the molecular formula C15H27N5O2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 3-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine.
| Compound Name | 3-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 109483075 |
| Molecular Formula | C15H27N5O2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 3-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCCN1C(=O)CNC1=O |
| InChI | InChI=1S/C15H27N5O2/c1-4-5-6-7-8-10-19(3)14(16-2)17-9-11-20-13(21)12-18-15(20)22/h4H,1,5-12H2,2-3H3,(H,16,17)(H,18,22) |
| InChIKey | CSWWJIRHWMQJFW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|