About 1-hept-6-enyl-3-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1,2-dimethylguanidine
1-hept-6-enyl-3-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1,2-dimethylguanidine (PubChem CID 109483099) has the molecular formula C19H38N4O
and a molecular weight of 338.54 g/mol. Its IUPAC name is 1-hept-6-enyl-3-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1,2-dimethylguanidine.
Molecular Properties
| Compound Name | 1-hept-6-enyl-3-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1,2-dimethylguanidine |
| PubChem CID | 109483099 |
| Molecular Formula | C19H38N4O |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.30 |
| IUPAC Name | 1-hept-6-enyl-3-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1,2-dimethylguanidine |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCC1CCN(CCOC)CC1 |
| InChI | InChI=1S/C19H38N4O/c1-5-6-7-8-9-12-22(3)19(20-2)21-17-18-10-13-23(14-11-18)15-16-24-4/h5,18H,1,6-17H2,2-4H3,(H,20,21) |
| InChIKey | ILJJTKMMWZELNQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-hept-6-enyl-3-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1,2-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hept-6-enyl-3-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1,2-dimethylguanidine?
The IUPAC name of 1-hept-6-enyl-3-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1,2-dimethylguanidine (CID 109483099) is 1-hept-6-enyl-3-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1,2-dimethylguanidine.
What is the SMILES notation for 1-hept-6-enyl-3-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1,2-dimethylguanidine?
The canonical SMILES for 1-hept-6-enyl-3-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1,2-dimethylguanidine is C=CCCCCCN(C)/C(=N\C)NCC1CCN(CCOC)CC1.
What is the InChIKey of 1-hept-6-enyl-3-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1,2-dimethylguanidine?
The InChIKey is ILJJTKMMWZELNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38N4O/c1-5-6-7-8-9-12-22(3)19(20-2)21-17-18-10-13-23(14-11-18)15-16-24-4/h5,18H,1,6-17H2,2-4H3,(H,20,21).
What are the key properties of 1-hept-6-enyl-3-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1,2-dimethylguanidine?
1-hept-6-enyl-3-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1,2-dimethylguanidine has a molecular weight of 338.54 g/mol, XLogP of 2.60, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hept-6-enyl-3-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1,2-dimethylguanidine is sourced from PubChem (CID 109483099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).