About 2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-propylacetamide
2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-propylacetamide (PubChem CID 109483239) has the molecular formula C15H30N4O
and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-propylacetamide.
Molecular Properties
| Compound Name | 2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-propylacetamide |
| PubChem CID | 109483239 |
| Molecular Formula | C15H30N4O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | 2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-propylacetamide |
| SMILES | C=CCCCCCN(C)/C(=N/C)NCC(=O)NCCC |
| InChI | InChI=1S/C15H30N4O/c1-5-7-8-9-10-12-19(4)15(16-3)18-13-14(20)17-11-6-2/h5H,1,6-13H2,2-4H3,(H,16,18)(H,17,20) |
| InChIKey | UPODDBXVPWWFJS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-propylacetamide?
The IUPAC name of 2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-propylacetamide (CID 109483239) is 2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-propylacetamide.
What is the SMILES notation for 2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-propylacetamide?
The canonical SMILES for 2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-propylacetamide is C=CCCCCCN(C)/C(=N/C)NCC(=O)NCCC.
What is the InChIKey of 2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-propylacetamide?
The InChIKey is UPODDBXVPWWFJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N4O/c1-5-7-8-9-10-12-19(4)15(16-3)18-13-14(20)17-11-6-2/h5H,1,6-13H2,2-4H3,(H,16,18)(H,17,20).
What are the key properties of 2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-propylacetamide?
2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-propylacetamide has a molecular weight of 282.43 g/mol, XLogP of 1.77, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-propylacetamide is sourced from PubChem (CID 109483239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).