About 3-[3-(cyclopropylmethoxy)propyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide
3-[3-(cyclopropylmethoxy)propyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide (PubChem CID 109483256) has the molecular formula C17H34IN3O
and a molecular weight of 423.38 g/mol. Its IUPAC name is 3-[3-(cyclopropylmethoxy)propyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide.
Molecular Properties
| Compound Name | 3-[3-(cyclopropylmethoxy)propyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide |
| PubChem CID | 109483256 |
| Molecular Formula | C17H34IN3O |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 3-[3-(cyclopropylmethoxy)propyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCCCOCC1CC1.I |
| InChI | InChI=1S/C17H33N3O.HI/c1-4-5-6-7-8-13-20(3)17(18-2)19-12-9-14-21-15-16-10-11-16;/h4,16H,1,5-15H2,2-3H3,(H,18,19);1H |
| InChIKey | ZNHPGFCTRWBUIY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(cyclopropylmethoxy)propyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(cyclopropylmethoxy)propyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide?
The IUPAC name of 3-[3-(cyclopropylmethoxy)propyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide (CID 109483256) is 3-[3-(cyclopropylmethoxy)propyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide.
What is the SMILES notation for 3-[3-(cyclopropylmethoxy)propyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide?
The canonical SMILES for 3-[3-(cyclopropylmethoxy)propyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide is C=CCCCCCN(C)/C(=N\C)NCCCOCC1CC1.I.
What is the InChIKey of 3-[3-(cyclopropylmethoxy)propyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide?
The InChIKey is ZNHPGFCTRWBUIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33N3O.HI/c1-4-5-6-7-8-13-20(3)17(18-2)19-12-9-14-21-15-16-10-11-16;/h4,16H,1,5-15H2,2-3H3,(H,18,19);1H.
What are the key properties of 3-[3-(cyclopropylmethoxy)propyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide?
3-[3-(cyclopropylmethoxy)propyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide has a molecular weight of 423.38 g/mol, XLogP of 3.67, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(cyclopropylmethoxy)propyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide is sourced from PubChem (CID 109483256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).