C15H27F3N4O — CID 109483313
2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 109483313) has the molecular formula C15H27F3N4O and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 109483313 |
| Molecular Formula | C15H27F3N4O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 2-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | C=CCCCCCN(C)/C(=N/C)NCC(=O)N(C)CC(F)(F)F |
| InChI | InChI=1S/C15H27F3N4O/c1-5-6-7-8-9-10-21(3)14(19-2)20-11-13(23)22(4)12-15(16,17)18/h5H,1,6-12H2,2-4H3,(H,19,20) |
| InChIKey | CWKYQQLVQIPQTI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|