About 1-hept-6-enyl-1,2-dimethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide
1-hept-6-enyl-1,2-dimethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 109483356) has the molecular formula C18H36IN3O2
and a molecular weight of 453.41 g/mol. Its IUPAC name is 1-hept-6-enyl-1,2-dimethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide.
Molecular Properties
| Compound Name | 1-hept-6-enyl-1,2-dimethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide |
| PubChem CID | 109483356 |
| Molecular Formula | C18H36IN3O2 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 1-hept-6-enyl-1,2-dimethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCCCOCC1CCOC1.I |
| InChI | InChI=1S/C18H35N3O2.HI/c1-4-5-6-7-8-12-21(3)18(19-2)20-11-9-13-22-15-17-10-14-23-16-17;/h4,17H,1,5-16H2,2-3H3,(H,19,20);1H |
| InChIKey | OCNCRQGKQKSYBK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-hept-6-enyl-1,2-dimethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hept-6-enyl-1,2-dimethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide?
The IUPAC name of 1-hept-6-enyl-1,2-dimethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide (CID 109483356) is 1-hept-6-enyl-1,2-dimethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide.
What is the SMILES notation for 1-hept-6-enyl-1,2-dimethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide?
The canonical SMILES for 1-hept-6-enyl-1,2-dimethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide is C=CCCCCCN(C)/C(=N\C)NCCCOCC1CCOC1.I.
What is the InChIKey of 1-hept-6-enyl-1,2-dimethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide?
The InChIKey is OCNCRQGKQKSYBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35N3O2.HI/c1-4-5-6-7-8-12-21(3)18(19-2)20-11-9-13-22-15-17-10-14-23-16-17;/h4,17H,1,5-16H2,2-3H3,(H,19,20);1H.
What are the key properties of 1-hept-6-enyl-1,2-dimethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide?
1-hept-6-enyl-1,2-dimethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide has a molecular weight of 453.41 g/mol, XLogP of 3.30, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hept-6-enyl-1,2-dimethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide is sourced from PubChem (CID 109483356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).