About ethyl 4-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]butanoate
ethyl 4-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]butanoate (PubChem CID 109483445) has the molecular formula C16H31N3O2
and a molecular weight of 297.44 g/mol. Its IUPAC name is ethyl 4-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]butanoate.
Molecular Properties
| Compound Name | ethyl 4-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]butanoate |
| PubChem CID | 109483445 |
| Molecular Formula | C16H31N3O2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | ethyl 4-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]butanoate |
| SMILES | C=CCCCCCN(C)/C(=N/C)NCCCC(=O)OCC |
| InChI | InChI=1S/C16H31N3O2/c1-5-7-8-9-10-14-19(4)16(17-3)18-13-11-12-15(20)21-6-2/h5H,1,6-14H2,2-4H3,(H,17,18) |
| InChIKey | LSGJXOXOWIWPTF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]butanoate?
The IUPAC name of ethyl 4-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]butanoate (CID 109483445) is ethyl 4-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]butanoate.
What is the SMILES notation for ethyl 4-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]butanoate?
The canonical SMILES for ethyl 4-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]butanoate is C=CCCCCCN(C)/C(=N/C)NCCCC(=O)OCC.
What is the InChIKey of ethyl 4-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]butanoate?
The InChIKey is LSGJXOXOWIWPTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31N3O2/c1-5-7-8-9-10-14-19(4)16(17-3)18-13-11-12-15(20)21-6-2/h5H,1,6-14H2,2-4H3,(H,17,18).
What are the key properties of ethyl 4-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]butanoate?
ethyl 4-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]butanoate has a molecular weight of 297.44 g/mol, XLogP of 2.58, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]butanoate is sourced from PubChem (CID 109483445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).