About 3-[2-(2,6-dioxopiperidin-1-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine
3-[2-(2,6-dioxopiperidin-1-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine (PubChem CID 109483551) has the molecular formula C17H30N4O2
and a molecular weight of 322.45 g/mol. Its IUPAC name is 3-[2-(2,6-dioxopiperidin-1-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine.
Molecular Properties
| Compound Name | 3-[2-(2,6-dioxopiperidin-1-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine |
| PubChem CID | 109483551 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 3-[2-(2,6-dioxopiperidin-1-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCCN1C(=O)CCCC1=O |
| InChI | InChI=1S/C17H30N4O2/c1-4-5-6-7-8-13-20(3)17(18-2)19-12-14-21-15(22)10-9-11-16(21)23/h4H,1,5-14H2,2-3H3,(H,18,19) |
| InChIKey | MOMUHXBSMHJRHJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2,6-dioxopiperidin-1-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,6-dioxopiperidin-1-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine?
The IUPAC name of 3-[2-(2,6-dioxopiperidin-1-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine (CID 109483551) is 3-[2-(2,6-dioxopiperidin-1-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine.
What is the SMILES notation for 3-[2-(2,6-dioxopiperidin-1-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine?
The canonical SMILES for 3-[2-(2,6-dioxopiperidin-1-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine is C=CCCCCCN(C)/C(=N\C)NCCN1C(=O)CCCC1=O.
What is the InChIKey of 3-[2-(2,6-dioxopiperidin-1-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine?
The InChIKey is MOMUHXBSMHJRHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N4O2/c1-4-5-6-7-8-13-20(3)17(18-2)19-12-14-21-15(22)10-9-11-16(21)23/h4H,1,5-14H2,2-3H3,(H,18,19).
What are the key properties of 3-[2-(2,6-dioxopiperidin-1-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine?
3-[2-(2,6-dioxopiperidin-1-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine has a molecular weight of 322.45 g/mol, XLogP of 1.78, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,6-dioxopiperidin-1-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine is sourced from PubChem (CID 109483551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).