C18H37IN4 — CID 109483844
1-hept-6-enyl-1,2-dimethyl-3-[(1-propylpyrrolidin-3-yl)methyl]guanidine;hydroiodide (PubChem CID 109483844) has the molecular formula C18H37IN4 and a molecular weight of 436.43 g/mol. Its IUPAC name is 1-hept-6-enyl-1,2-dimethyl-3-[(1-propylpyrrolidin-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-hept-6-enyl-1,2-dimethyl-3-[(1-propylpyrrolidin-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109483844 |
| Molecular Formula | C18H37IN4 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 1-hept-6-enyl-1,2-dimethyl-3-[(1-propylpyrrolidin-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCC1CCN(CCC)C1.I |
| InChI | InChI=1S/C18H36N4.HI/c1-5-7-8-9-10-13-21(4)18(19-3)20-15-17-11-14-22(16-17)12-6-2;/h5,17H,1,6-16H2,2-4H3,(H,19,20);1H |
| InChIKey | HDLDFIAMROKERG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|