C21H32O3Si — CID 10948407
(5aS,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-8,9a-dimethyl-1,2,3,5,5a,9b-hexahydrocyclopenta[a]naphthalene-6,9-dione (PubChem CID 10948407) has the molecular formula C21H32O3Si and a molecular weight of 360.57 g/mol. Its IUPAC name is (5aS,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-8,9a-dimethyl-1,2,3,5,5a,9b-hexahydrocyclopenta[a]naphthalene-6,9-dione.
| Compound Name | (5aS,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-8,9a-dimethyl-1,2,3,5,5a,9b-hexahydrocyclopenta[a]naphthalene-6,9-dione |
|---|---|
| PubChem CID | 10948407 |
| Molecular Formula | C21H32O3Si |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | (5aS,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-8,9a-dimethyl-1,2,3,5,5a,9b-hexahydrocyclopenta[a]naphthalene-6,9-dione |
| SMILES | CC1=CC(=O)[C@H]2CC(O[Si](C)(C)C(C)(C)C)=C3CCC[C@H]3[C@@]2(C)C1=O |
| InChI | InChI=1S/C21H32O3Si/c1-13-11-17(22)16-12-18(24-25(6,7)20(2,3)4)14-9-8-10-15(14)21(16,5)19(13)23/h11,15-16H,8-10,12H2,1-7H3/t15-,16-,21-/m1/s1 |
| InChIKey | CWOXYUKPEZHHAO-WHSLLNHNSA-N |
| XLogP | 5.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|