C20H36N6 — CID 109484145
3-ethyl-1-hept-6-enyl-1-methyl-2-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine (PubChem CID 109484145) has the molecular formula C20H36N6 and a molecular weight of 360.55 g/mol. Its IUPAC name is 3-ethyl-1-hept-6-enyl-1-methyl-2-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine.
| Compound Name | 3-ethyl-1-hept-6-enyl-1-methyl-2-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 109484145 |
| Molecular Formula | C20H36N6 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | 3-ethyl-1-hept-6-enyl-1-methyl-2-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine |
| SMILES | C=CCCCCCN(C)/C(=N/CCc1nnc2n1CCCCC2)NCC |
| InChI | InChI=1S/C20H36N6/c1-4-6-7-8-11-16-25(3)20(21-5-2)22-15-14-19-24-23-18-13-10-9-12-17-26(18)19/h4H,1,5-17H2,2-3H3,(H,21,22) |
| InChIKey | RGSWXAPMNLPSHR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|