C22H23NO4 — CID 10948526
ethyl (E)-3-[(2S,3R)-1-benzyl-4-oxo-3-phenylmethoxyazetidin-2-yl]prop-2-enoate (PubChem CID 10948526) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is ethyl (E)-3-[(2S,3R)-1-benzyl-4-oxo-3-phenylmethoxyazetidin-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2S,3R)-1-benzyl-4-oxo-3-phenylmethoxyazetidin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10948526 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | ethyl (E)-3-[(2S,3R)-1-benzyl-4-oxo-3-phenylmethoxyazetidin-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1[C@@H](OCc2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H23NO4/c1-2-26-20(24)14-13-19-21(27-16-18-11-7-4-8-12-18)22(25)23(19)15-17-9-5-3-6-10-17/h3-14,19,21H,2,15-16H2,1H3/b14-13+/t19-,21+/m0/s1 |
| InChIKey | VHYXCIDROAQPBJ-KNJPYWDESA-N |
| XLogP | 3.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|