About 4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)butan-1-one
4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)butan-1-one (PubChem CID 10948529) has the molecular formula C21H23N3O3
and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)butan-1-one.
Molecular Properties
| Compound Name | 4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)butan-1-one |
| PubChem CID | 10948529 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)butan-1-one |
| SMILES | O=C(CCCN1CCN(c2noc3ccccc23)CC1)c1ccccc1O |
| InChI | InChI=1S/C21H23N3O3/c25-18-8-3-1-6-16(18)19(26)9-5-11-23-12-14-24(15-13-23)21-17-7-2-4-10-20(17)27-22-21/h1-4,6-8,10,25H,5,9,11-15H2 |
| InChIKey | NXHKMBHNFYBTMT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)butan-1-one?
The IUPAC name of 4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)butan-1-one (CID 10948529) is 4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)butan-1-one.
What is the SMILES notation for 4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)butan-1-one?
The canonical SMILES for 4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)butan-1-one is O=C(CCCN1CCN(c2noc3ccccc23)CC1)c1ccccc1O.
What is the InChIKey of 4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)butan-1-one?
The InChIKey is NXHKMBHNFYBTMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O3/c25-18-8-3-1-6-16(18)19(26)9-5-11-23-12-14-24(15-13-23)21-17-7-2-4-10-20(17)27-22-21/h1-4,6-8,10,25H,5,9,11-15H2.
What are the key properties of 4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)butan-1-one?
4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)butan-1-one has a molecular weight of 365.43 g/mol, XLogP of 3.32, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-1-(2-hydroxyphenyl)butan-1-one is sourced from PubChem (CID 10948529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).