C15H23F3N4S2 — CID 109485328
N,2-diethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]thiomorpholine-4-carboximidamide (PubChem CID 109485328) has the molecular formula C15H23F3N4S2 and a molecular weight of 380.51 g/mol. Its IUPAC name is N,2-diethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]thiomorpholine-4-carboximidamide.
| Compound Name | N,2-diethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109485328 |
| Molecular Formula | C15H23F3N4S2 |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N,2-diethyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]thiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\CCc1nc(C(F)(F)F)cs1)N1CCSC(CC)C1 |
| InChI | InChI=1S/C15H23F3N4S2/c1-3-11-9-22(7-8-23-11)14(19-4-2)20-6-5-13-21-12(10-24-13)15(16,17)18/h10-11H,3-9H2,1-2H3,(H,19,20) |
| InChIKey | LMLUSDBJAREHAO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|